C30H40Cl2N4O6S3Si — CID 174058111
[(1R,2S,4R)-4-[[5-[5-chloro-4-(3-chlorophenyl)sulfinylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-tri(propan-2-yl)silyloxycyclopentyl]methylsulfamic acid (PubChem CID 174058111) has the molecular formula C30H40Cl2N4O6S3Si and a molecular weight of 747.87 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[5-[5-chloro-4-(3-chlorophenyl)sulfinylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-tri(propan-2-yl)silyloxycyclopentyl]methylsulfamic acid.
| Compound Name | [(1R,2S,4R)-4-[[5-[5-chloro-4-(3-chlorophenyl)sulfinylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-tri(propan-2-yl)silyloxycyclopentyl]methylsulfamic acid |
|---|---|
| PubChem CID | 174058111 |
| Molecular Formula | C30H40Cl2N4O6S3Si |
| Molecular Weight | 747.87 g/mol |
| Exact Mass | 746.13 |
| IUPAC Name | [(1R,2S,4R)-4-[[5-[5-chloro-4-(3-chlorophenyl)sulfinylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-tri(propan-2-yl)silyloxycyclopentyl]methylsulfamic acid |
| SMILES | CC(C)[Si](O[C@H]1C[C@H](Nc2ncncc2C(=O)c2cc(S(=O)c3cccc(Cl)c3)c(Cl)s2)C[C@@H]1CNS(=O)(=O)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H40Cl2N4O6S3Si/c1-17(2)46(18(3)4,19(5)6)42-25-12-22(10-20(25)14-35-45(39,40)41)36-30-24(15-33-16-34-30)28(37)26-13-27(29(32)43-26)44(38)23-9-7-8-21(31)11-23/h7-9,11,13,15-20,22,25,35H,10,12,14H2,1-6H3,(H,33,34,36)(H,39,40,41)/t20-,22-,25+,44?/m1/s1 |
| InChIKey | CZIJVZNHHIPZNJ-ZUGGQTEGSA-N |
| XLogP | 7.39 |
| TPSA | 147.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.87 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|