About 3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine
3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine (PubChem CID 174058455) has the molecular formula C19H25F2NOSi
and a molecular weight of 349.50 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine.
Molecular Properties
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine |
| PubChem CID | 174058455 |
| Molecular Formula | C19H25F2NOSi |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine |
| SMILES | CC(C)(C)[Si](OCC(N)C(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25F2NOSi/c1-19(2,3)24(15-10-6-4-7-11-15,16-12-8-5-9-13-16)23-14-17(22)18(20)21/h4-13,17-18H,14,22H2,1-3H3 |
| InChIKey | UQXFIOCVYSZOQY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine?
The IUPAC name of 3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine (CID 174058455) is 3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine.
What is the SMILES notation for 3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine?
The canonical SMILES for 3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine is CC(C)(C)[Si](OCC(N)C(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine?
The InChIKey is UQXFIOCVYSZOQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25F2NOSi/c1-19(2,3)24(15-10-6-4-7-11-15,16-12-8-5-9-13-16)23-14-17(22)18(20)21/h4-13,17-18H,14,22H2,1-3H3.
What are the key properties of 3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine?
3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine has a molecular weight of 349.50 g/mol, XLogP of 3.16, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl(diphenyl)silyl]oxy-1,1-difluoropropan-2-amine is sourced from PubChem (CID 174058455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).