C11H15N3O3 — CID 174058525
4-amino-1-[(2R,4S,5R)-5-ethenyl-4-hydroxy-5-methyloxolan-2-yl]pyrimidin-2-one (PubChem CID 174058525) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-amino-1-[(2R,4S,5R)-5-ethenyl-4-hydroxy-5-methyloxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4S,5R)-5-ethenyl-4-hydroxy-5-methyloxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 174058525 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-5-ethenyl-4-hydroxy-5-methyloxolan-2-yl]pyrimidin-2-one |
| SMILES | C=C[C@@]1(C)O[C@@H](n2ccc(N)nc2=O)C[C@@H]1O |
| InChI | InChI=1S/C11H15N3O3/c1-3-11(2)7(15)6-9(17-11)14-5-4-8(12)13-10(14)16/h3-5,7,9,15H,1,6H2,2H3,(H2,12,13,16)/t7-,9+,11+/m0/s1 |
| InChIKey | LNYKKHXVICLCCU-JVUFJMBOSA-N |
| XLogP | 0.05 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|