C24H36Fe — CID 174058655
bis(1,2,3,4,5,6-hexamethylbenzene);iron (PubChem CID 174058655) has the molecular formula C24H36Fe and a molecular weight of 380.40 g/mol. Its IUPAC name is bis(1,2,3,4,5,6-hexamethylbenzene);iron.
| Compound Name | bis(1,2,3,4,5,6-hexamethylbenzene);iron |
|---|---|
| PubChem CID | 174058655 |
| Molecular Formula | C24H36Fe |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | bis(1,2,3,4,5,6-hexamethylbenzene);iron |
| SMILES | Cc1c(C)c(C)c(C)c(C)c1C.Cc1c(C)c(C)c(C)c(C)c1C.[Fe] |
| InChI | InChI=1S/2C12H18.Fe/c2*1-7-8(2)10(4)12(6)11(5)9(7)3;/h2*1-6H3; |
| InChIKey | NWCKADPLZWOQJL-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|