C18H24Mo — CID 174058694
1,2-diethylbenzene;ethylbenzene;molybdenum (PubChem CID 174058694) has the molecular formula C18H24Mo and a molecular weight of 336.33 g/mol. Its IUPAC name is 1,2-diethylbenzene;ethylbenzene;molybdenum.
| Compound Name | 1,2-diethylbenzene;ethylbenzene;molybdenum |
|---|---|
| PubChem CID | 174058694 |
| Molecular Formula | C18H24Mo |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1,2-diethylbenzene;ethylbenzene;molybdenum |
| SMILES | CCc1ccccc1.CCc1ccccc1CC.[Mo] |
| InChI | InChI=1S/C10H14.C8H10.Mo/c1-3-9-7-5-6-8-10(9)4-2;1-2-8-6-4-3-5-7-8;/h5-8H,3-4H2,1-2H3;3-7H,2H2,1H3; |
| InChIKey | YFYABOPQZQOWNB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |