C79H135F3NP2Si4+ — CID 174058720
[bis(4-tributylsilylphenyl)phosphanylamino]-bis(4-tributylsilylphenyl)-[3-(trifluoromethyl)cyclohexyl]phosphanium (PubChem CID 174058720) has the molecular formula C79H135F3NP2Si4+ and a molecular weight of 1330.24 g/mol. Its IUPAC name is [bis(4-tributylsilylphenyl)phosphanylamino]-bis(4-tributylsilylphenyl)-[3-(trifluoromethyl)cyclohexyl]phosphanium.
| Compound Name | [bis(4-tributylsilylphenyl)phosphanylamino]-bis(4-tributylsilylphenyl)-[3-(trifluoromethyl)cyclohexyl]phosphanium |
|---|---|
| PubChem CID | 174058720 |
| Molecular Formula | C79H135F3NP2Si4+ |
| Molecular Weight | 1330.24 g/mol |
| Exact Mass | 1328.91 |
| IUPAC Name | [bis(4-tributylsilylphenyl)phosphanylamino]-bis(4-tributylsilylphenyl)-[3-(trifluoromethyl)cyclohexyl]phosphanium |
| SMILES | CCCC[Si](CCCC)(CCCC)c1ccc(P(N[P+](c2ccc([Si](CCCC)(CCCC)CCCC)cc2)(c2ccc([Si](CCCC)(CCCC)CCCC)cc2)C2CCCC(C(F)(F)F)C2)c2ccc([Si](CCCC)(CCCC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C79H135F3NP2Si4/c1-13-25-56-86(57-26-14-2,58-27-15-3)75-48-40-70(41-49-75)84(71-42-50-76(51-43-71)87(59-28-16-4,60-29-17-5)61-30-18-6)83-85(74-39-37-38-69(68-74)79(80,81)82,72-44-52-77(53-45-72)88(62-31-19-7,63-32-20-8)64-33-21-9)73-46-54-78(55-47-73)89(65-34-22-10,66-35-23-11)67-36-24-12/h40-55,69,74,83H,13-39,56-68H2,1-12H3/q+1 |
| InChIKey | HBKLOIAGUUISBJ-UHFFFAOYSA-N |
| XLogP | 23.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1330.24 |
| LogP ≤ 5 | 23.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|