About alumane;ethyl-oxo-phosphonooxyphosphanium
alumane;ethyl-oxo-phosphonooxyphosphanium (PubChem CID 174058840) has the molecular formula C2H10AlO5P2+
and a molecular weight of 203.03 g/mol. Its IUPAC name is alumane;ethyl-oxo-phosphonooxyphosphanium.
Molecular Properties
| Compound Name | alumane;ethyl-oxo-phosphonooxyphosphanium |
| PubChem CID | 174058840 |
| Molecular Formula | C2H10AlO5P2+ |
| Molecular Weight | 203.03 g/mol |
| Exact Mass | 202.98 |
| IUPAC Name | alumane;ethyl-oxo-phosphonooxyphosphanium |
| SMILES | CC[P+](=O)OP(=O)(O)O.[AlH3] |
| InChI | InChI=1S/C2H6O5P2.Al.3H/c1-2-8(3)7-9(4,5)6;;;;/h2H2,1H3,(H-,4,5,6);;;;/p+1 |
| InChIKey | MXUQUWJSDVIIJX-UHFFFAOYSA-O |
| XLogP | -0.33 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.03 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze alumane;ethyl-oxo-phosphonooxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;ethyl-oxo-phosphonooxyphosphanium?
The IUPAC name of alumane;ethyl-oxo-phosphonooxyphosphanium (CID 174058840) is alumane;ethyl-oxo-phosphonooxyphosphanium.
What is the SMILES notation for alumane;ethyl-oxo-phosphonooxyphosphanium?
The canonical SMILES for alumane;ethyl-oxo-phosphonooxyphosphanium is CC[P+](=O)OP(=O)(O)O.[AlH3].
What is the InChIKey of alumane;ethyl-oxo-phosphonooxyphosphanium?
The InChIKey is MXUQUWJSDVIIJX-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H6O5P2.Al.3H/c1-2-8(3)7-9(4,5)6;;;;/h2H2,1H3,(H-,4,5,6);;;;/p+1.
What are the key properties of alumane;ethyl-oxo-phosphonooxyphosphanium?
alumane;ethyl-oxo-phosphonooxyphosphanium has a molecular weight of 203.03 g/mol, XLogP of -0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;ethyl-oxo-phosphonooxyphosphanium is sourced from PubChem (CID 174058840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).