C29H35FI2N4O3Si — CID 174059482
2-[[4-[3-(4,5-diiodo-1H-imidazol-2-yl)-7-fluoro-1-(oxan-2-yl)indazol-6-yl]-3-ethylphenoxy]methoxy]ethyl-trimethylsilane (PubChem CID 174059482) has the molecular formula C29H35FI2N4O3Si and a molecular weight of 788.52 g/mol. Its IUPAC name is 2-[[4-[3-(4,5-diiodo-1H-imidazol-2-yl)-7-fluoro-1-(oxan-2-yl)indazol-6-yl]-3-ethylphenoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[3-(4,5-diiodo-1H-imidazol-2-yl)-7-fluoro-1-(oxan-2-yl)indazol-6-yl]-3-ethylphenoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 174059482 |
| Molecular Formula | C29H35FI2N4O3Si |
| Molecular Weight | 788.52 g/mol |
| Exact Mass | 788.06 |
| IUPAC Name | 2-[[4-[3-(4,5-diiodo-1H-imidazol-2-yl)-7-fluoro-1-(oxan-2-yl)indazol-6-yl]-3-ethylphenoxy]methoxy]ethyl-trimethylsilane |
| SMILES | CCc1cc(OCOCC[Si](C)(C)C)ccc1-c1ccc2c(-c3nc(I)c(I)[nH]3)nn(C3CCCCO3)c2c1F |
| InChI | InChI=1S/C29H35FI2N4O3Si/c1-5-18-16-19(39-17-37-14-15-40(2,3)4)9-10-20(18)21-11-12-22-25(29-33-27(31)28(32)34-29)35-36(26(22)24(21)30)23-8-6-7-13-38-23/h9-12,16,23H,5-8,13-15,17H2,1-4H3,(H,33,34) |
| InChIKey | KUJNAQORJIUANM-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.52 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|