C9H11FO2 — CID 174059502
5-fluoro-1,4,4a,7,8,8a-hexahydroisochromen-3-one (PubChem CID 174059502) has the molecular formula C9H11FO2 and a molecular weight of 170.18 g/mol. Its IUPAC name is 5-fluoro-1,4,4a,7,8,8a-hexahydroisochromen-3-one.
| Compound Name | 5-fluoro-1,4,4a,7,8,8a-hexahydroisochromen-3-one |
|---|---|
| PubChem CID | 174059502 |
| Molecular Formula | C9H11FO2 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 5-fluoro-1,4,4a,7,8,8a-hexahydroisochromen-3-one |
| SMILES | O=C1CC2C(F)=CCCC2CO1 |
| InChI | InChI=1S/C9H11FO2/c10-8-3-1-2-6-5-12-9(11)4-7(6)8/h3,6-7H,1-2,4-5H2 |
| InChIKey | YVVGSMTZARBCJE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |