C25H37F2N7O3Si — CID 174059503
[3,3-difluoro-5-[2-(2-methylpropyl)-6-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]imidazo[4,5-c]pyridin-1-yl]cyclohexyl]carbamic acid (PubChem CID 174059503) has the molecular formula C25H37F2N7O3Si and a molecular weight of 549.70 g/mol. Its IUPAC name is [3,3-difluoro-5-[2-(2-methylpropyl)-6-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]imidazo[4,5-c]pyridin-1-yl]cyclohexyl]carbamic acid.
| Compound Name | [3,3-difluoro-5-[2-(2-methylpropyl)-6-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]imidazo[4,5-c]pyridin-1-yl]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 174059503 |
| Molecular Formula | C25H37F2N7O3Si |
| Molecular Weight | 549.70 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | [3,3-difluoro-5-[2-(2-methylpropyl)-6-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]imidazo[4,5-c]pyridin-1-yl]cyclohexyl]carbamic acid |
| SMILES | CC(C)Cc1nc2cnc(-c3ncn(COCC[Si](C)(C)C)n3)cc2n1C1CC(NC(=O)O)CC(F)(F)C1 |
| InChI | InChI=1S/C25H37F2N7O3Si/c1-16(2)8-22-31-20-13-28-19(23-29-14-33(32-23)15-37-6-7-38(3,4)5)10-21(20)34(22)18-9-17(30-24(35)36)11-25(26,27)12-18/h10,13-14,16-18,30H,6-9,11-12,15H2,1-5H3,(H,35,36) |
| InChIKey | VKODFOGNKGQCFA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.70 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|