C17H21N3O5Si — CID 174059991
1-[2-oxo-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-5-yl]pyrimidine-2,4-dione (PubChem CID 174059991) has the molecular formula C17H21N3O5Si and a molecular weight of 375.46 g/mol. Its IUPAC name is 1-[2-oxo-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-5-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-oxo-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-5-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174059991 |
| Molecular Formula | C17H21N3O5Si |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-[2-oxo-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-5-yl]pyrimidine-2,4-dione |
| SMILES | C[Si](C)(C)CCOCn1c(=O)oc2ccc(-n3ccc(=O)[nH]c3=O)cc21 |
| InChI | InChI=1S/C17H21N3O5Si/c1-26(2,3)9-8-24-11-20-13-10-12(4-5-14(13)25-17(20)23)19-7-6-15(21)18-16(19)22/h4-7,10H,8-9,11H2,1-3H3,(H,18,21,22) |
| InChIKey | DMXHYLQBMPILEF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|