About 7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium
7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium (PubChem CID 174060181) has the molecular formula C9H8CdOSe
and a molecular weight of 323.53 g/mol. Its IUPAC name is 7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium.
Molecular Properties
| Compound Name | 7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium |
| PubChem CID | 174060181 |
| Molecular Formula | C9H8CdOSe |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 325.88 |
| IUPAC Name | 7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium |
| SMILES | [Cd].c1ccc2c(c1)CC1[Se]C1O2 |
| InChI | InChI=1S/C9H8OSe.Cd/c1-2-4-7-6(3-1)5-8-9(10-7)11-8;/h1-4,8-9H,5H2; |
| InChIKey | MIYRZLAWEJDLHX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium?
The IUPAC name of 7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium (CID 174060181) is 7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium.
What is the SMILES notation for 7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium?
The canonical SMILES for 7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium is [Cd].c1ccc2c(c1)CC1[Se]C1O2.
What is the InChIKey of 7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium?
The InChIKey is MIYRZLAWEJDLHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8OSe.Cd/c1-2-4-7-6(3-1)5-8-9(10-7)11-8;/h1-4,8-9H,5H2;.
What are the key properties of 7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium?
7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium has a molecular weight of 323.53 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7a-dihydro-1aH-selenireno[2,3-b]chromene;cadmium is sourced from PubChem (CID 174060181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).