About dilithium;hydroxymethanediolate
dilithium;hydroxymethanediolate (PubChem CID 174060221) has the molecular formula CH2Li2O3
and a molecular weight of 75.91 g/mol. Its IUPAC name is dilithium;hydroxymethanediolate.
Molecular Properties
| Compound Name | dilithium;hydroxymethanediolate |
| PubChem CID | 174060221 |
| Molecular Formula | CH2Li2O3 |
| Molecular Weight | 75.91 g/mol |
| Exact Mass | 76.03 |
| IUPAC Name | dilithium;hydroxymethanediolate |
| SMILES | [Li+].[Li+].[O-]C([O-])O |
| InChI | InChI=1S/CH2O3.2Li/c2-1(3)4;;/h1-2H;;/q-2;2*+1 |
| InChIKey | RFNSIPVHCXRBNO-UHFFFAOYSA-N |
| XLogP | -9.01 |
| TPSA | 66.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 75.91 |
| LogP ≤ 5 | -9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dilithium;hydroxymethanediolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;hydroxymethanediolate?
The IUPAC name of dilithium;hydroxymethanediolate (CID 174060221) is dilithium;hydroxymethanediolate.
What is the SMILES notation for dilithium;hydroxymethanediolate?
The canonical SMILES for dilithium;hydroxymethanediolate is [Li+].[Li+].[O-]C([O-])O.
What is the InChIKey of dilithium;hydroxymethanediolate?
The InChIKey is RFNSIPVHCXRBNO-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.2Li/c2-1(3)4;;/h1-2H;;/q-2;2*+1.
What are the key properties of dilithium;hydroxymethanediolate?
dilithium;hydroxymethanediolate has a molecular weight of 75.91 g/mol, XLogP of -9.01, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;hydroxymethanediolate is sourced from PubChem (CID 174060221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).