About N,N-diethylethanamine;1H-imidazole;hydrochloride
N,N-diethylethanamine;1H-imidazole;hydrochloride (PubChem CID 174060282) has the molecular formula C9H20ClN3
and a molecular weight of 205.73 g/mol. Its IUPAC name is N,N-diethylethanamine;1H-imidazole;hydrochloride.
Molecular Properties
| Compound Name | N,N-diethylethanamine;1H-imidazole;hydrochloride |
| PubChem CID | 174060282 |
| Molecular Formula | C9H20ClN3 |
| Molecular Weight | 205.73 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N,N-diethylethanamine;1H-imidazole;hydrochloride |
| SMILES | CCN(CC)CC.Cl.c1c[nH]cn1 |
| InChI | InChI=1S/C6H15N.C3H4N2.ClH/c1-4-7(5-2)6-3;1-2-5-3-4-1;/h4-6H2,1-3H3;1-3H,(H,4,5);1H |
| InChIKey | MZRJHFNCELHZLX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.73 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylethanamine;1H-imidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;1H-imidazole;hydrochloride?
The IUPAC name of N,N-diethylethanamine;1H-imidazole;hydrochloride (CID 174060282) is N,N-diethylethanamine;1H-imidazole;hydrochloride.
What is the SMILES notation for N,N-diethylethanamine;1H-imidazole;hydrochloride?
The canonical SMILES for N,N-diethylethanamine;1H-imidazole;hydrochloride is CCN(CC)CC.Cl.c1c[nH]cn1.
What is the InChIKey of N,N-diethylethanamine;1H-imidazole;hydrochloride?
The InChIKey is MZRJHFNCELHZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C3H4N2.ClH/c1-4-7(5-2)6-3;1-2-5-3-4-1;/h4-6H2,1-3H3;1-3H,(H,4,5);1H.
What are the key properties of N,N-diethylethanamine;1H-imidazole;hydrochloride?
N,N-diethylethanamine;1H-imidazole;hydrochloride has a molecular weight of 205.73 g/mol, XLogP of 2.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;1H-imidazole;hydrochloride is sourced from PubChem (CID 174060282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).