C16H26 — CID 174060395
8-ethenyl-3,4,4-trimethyl-7-methylidene-1,2,3,4a,5,6,8,8a-octahydronaphthalene (PubChem CID 174060395) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 8-ethenyl-3,4,4-trimethyl-7-methylidene-1,2,3,4a,5,6,8,8a-octahydronaphthalene.
| Compound Name | 8-ethenyl-3,4,4-trimethyl-7-methylidene-1,2,3,4a,5,6,8,8a-octahydronaphthalene |
|---|---|
| PubChem CID | 174060395 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 8-ethenyl-3,4,4-trimethyl-7-methylidene-1,2,3,4a,5,6,8,8a-octahydronaphthalene |
| SMILES | C=CC1C(=C)CCC2C1CCC(C)C2(C)C |
| InChI | InChI=1S/C16H26/c1-6-13-11(2)7-10-15-14(13)9-8-12(3)16(15,4)5/h6,12-15H,1-2,7-10H2,3-5H3 |
| InChIKey | HJXBMSMMIKHOTA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|