C43H8BF28N — CID 174060481
prop-2-enylazanium;tetrakis(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)boranuide (PubChem CID 174060481) has the molecular formula C43H8BF28N and a molecular weight of 1081.30 g/mol. Its IUPAC name is prop-2-enylazanium;tetrakis(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)boranuide.
| Compound Name | prop-2-enylazanium;tetrakis(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)boranuide |
|---|---|
| PubChem CID | 174060481 |
| Molecular Formula | C43H8BF28N |
| Molecular Weight | 1081.30 g/mol |
| Exact Mass | 1081.03 |
| IUPAC Name | prop-2-enylazanium;tetrakis(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)boranuide |
| SMILES | C=CC[NH3+].Fc1c(F)c(F)c2c([B-](c3c(F)c(F)c(F)c4c(F)c(F)c(F)c(F)c34)(c3c(F)c(F)c(F)c4c(F)c(F)c(F)c(F)c34)c3c(F)c(F)c(F)c4c(F)c(F)c(F)c(F)c34)c(F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C40BF28.C3H7N/c42-13-1-5(21(50)37(66)33(13)62)17(46)29(58)25(54)9(1)41(10-2-6(18(47)30(59)26(10)55)22(51)38(67)34(63)14(2)43,11-3-7(19(48)31(60)27(11)56)23(52)39(68)35(64)15(3)44)12-4-8(20(49)32(61)28(12)57)24(53)40(69)36(65)16(4)45;1-2-3-4/h;2H,1,3-4H2/q-1;/p+1 |
| InChIKey | CYWWRPPXBJFYLY-UHFFFAOYSA-O |
| XLogP | 10.99 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1081.30 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|