About (1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone
(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone (PubChem CID 17406052) has the molecular formula C19H25N3OS
and a molecular weight of 343.50 g/mol. Its IUPAC name is (1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | (1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone |
| PubChem CID | 17406052 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCN(Cc3ccsc3)CC2)c(C)n1C1CC1 |
| InChI | InChI=1S/C19H25N3OS/c1-14-11-18(15(2)22(14)17-3-4-17)19(23)21-8-6-20(7-9-21)12-16-5-10-24-13-16/h5,10-11,13,17H,3-4,6-9,12H2,1-2H3 |
| InChIKey | WDXWSDFRXVLOEL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone?
The IUPAC name of (1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone (CID 17406052) is (1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone.
What is the SMILES notation for (1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone?
The canonical SMILES for (1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone is Cc1cc(C(=O)N2CCN(Cc3ccsc3)CC2)c(C)n1C1CC1.
What is the InChIKey of (1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone?
The InChIKey is WDXWSDFRXVLOEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3OS/c1-14-11-18(15(2)22(14)17-3-4-17)19(23)21-8-6-20(7-9-21)12-16-5-10-24-13-16/h5,10-11,13,17H,3-4,6-9,12H2,1-2H3.
What are the key properties of (1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone?
(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone has a molecular weight of 343.50 g/mol, XLogP of 3.46, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone is sourced from PubChem (CID 17406052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).