About sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride
sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride (PubChem CID 174060604) has the molecular formula C28H51NaO7
and a molecular weight of 522.70 g/mol. Its IUPAC name is sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride.
Molecular Properties
| Compound Name | sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride |
| PubChem CID | 174060604 |
| Molecular Formula | C28H51NaO7 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride |
| SMILES | CCCCCC(=O)OC(CCCCC)CCCC(=O)OC(=O)CCCC(CCCCC)OC(C)=O.[H-].[Na+] |
| InChI | InChI=1S/C28H50O7.Na.H/c1-5-8-11-16-24(33-23(4)29)18-14-21-27(31)35-28(32)22-15-19-25(17-12-9-6-2)34-26(30)20-13-10-7-3;;/h24-25H,5-22H2,1-4H3;;/q;+1;-1 |
| InChIKey | NWKCQQRJWVVZML-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride?
The IUPAC name of sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride (CID 174060604) is sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride.
What is the SMILES notation for sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride?
The canonical SMILES for sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride is CCCCCC(=O)OC(CCCCC)CCCC(=O)OC(=O)CCCC(CCCCC)OC(C)=O.[H-].[Na+].
What is the InChIKey of sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride?
The InChIKey is NWKCQQRJWVVZML-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H50O7.Na.H/c1-5-8-11-16-24(33-23(4)29)18-14-21-27(31)35-28(32)22-15-19-25(17-12-9-6-2)34-26(30)20-13-10-7-3;;/h24-25H,5-22H2,1-4H3;;/q;+1;-1.
What are the key properties of sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride?
sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride has a molecular weight of 522.70 g/mol, XLogP of 4.10, 22 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;5-hexanoyloxydecanoyl 5-acetyloxydecanoate;hydride is sourced from PubChem (CID 174060604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).