C28H35BN2O6 — CID 174060660
2-(1,3-dioxoisoindol-2-yl)-3-methoxy-N-[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]propanamide (PubChem CID 174060660) has the molecular formula C28H35BN2O6 and a molecular weight of 506.41 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-3-methoxy-N-[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]propanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-3-methoxy-N-[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]propanamide |
|---|---|
| PubChem CID | 174060660 |
| Molecular Formula | C28H35BN2O6 |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-3-methoxy-N-[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]propanamide |
| SMILES | COCC(C(=O)NC(CCCc1ccccc1)B1OC(C)(C)C(C)(C)O1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H35BN2O6/c1-27(2)28(3,4)37-29(36-27)23(17-11-14-19-12-7-6-8-13-19)30-24(32)22(18-35-5)31-25(33)20-15-9-10-16-21(20)26(31)34/h6-10,12-13,15-16,22-23H,11,14,17-18H2,1-5H3,(H,30,32) |
| InChIKey | UBXGCPOFZLAEIY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|