C28H32ClF4N5O2Si — CID 174060819
(8aR)-7-(6-amino-3-chloro-2-fluorophenyl)-3-[5-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrol-3-yl]-1H-imidazol-2-yl]-2,3,8,8a-tetrahydro-1H-indolizin-5-one (PubChem CID 174060819) has the molecular formula C28H32ClF4N5O2Si and a molecular weight of 610.13 g/mol. Its IUPAC name is (8aR)-7-(6-amino-3-chloro-2-fluorophenyl)-3-[5-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrol-3-yl]-1H-imidazol-2-yl]-2,3,8,8a-tetrahydro-1H-indolizin-5-one.
| Compound Name | (8aR)-7-(6-amino-3-chloro-2-fluorophenyl)-3-[5-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrol-3-yl]-1H-imidazol-2-yl]-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 174060819 |
| Molecular Formula | C28H32ClF4N5O2Si |
| Molecular Weight | 610.13 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | (8aR)-7-(6-amino-3-chloro-2-fluorophenyl)-3-[5-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrol-3-yl]-1H-imidazol-2-yl]-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cnc(C3CC[C@@H]4CC(c5c(N)ccc(Cl)c5F)=CC(=O)N34)[nH]2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H32ClF4N5O2Si/c1-41(2,3)9-8-40-15-37-13-18(19(14-37)28(31,32)33)22-12-35-27(36-22)23-7-4-17-10-16(11-24(39)38(17)23)25-21(34)6-5-20(29)26(25)30/h5-6,11-14,17,23H,4,7-10,15,34H2,1-3H3,(H,35,36)/t17-,23?/m1/s1 |
| InChIKey | CPVJXTIGQRYMJR-LIXIDFRTSA-N |
| XLogP | 7.10 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.13 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|