C25H17NO7 — CID 174060917
methyl 4-(6,11-dihydroxy-7,10-dioxo-13H-naphtho[2,3-b][1,4]benzoxazepin-12-yl)benzoate (PubChem CID 174060917) has the molecular formula C25H17NO7 and a molecular weight of 443.41 g/mol. Its IUPAC name is methyl 4-(6,11-dihydroxy-7,10-dioxo-13H-naphtho[2,3-b][1,4]benzoxazepin-12-yl)benzoate.
| Compound Name | methyl 4-(6,11-dihydroxy-7,10-dioxo-13H-naphtho[2,3-b][1,4]benzoxazepin-12-yl)benzoate |
|---|---|
| PubChem CID | 174060917 |
| Molecular Formula | C25H17NO7 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | methyl 4-(6,11-dihydroxy-7,10-dioxo-13H-naphtho[2,3-b][1,4]benzoxazepin-12-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2Cc3ccccc3Oc3c(O)c4c(c(O)c32)C(=O)C=CC4=O)cc1 |
| InChI | InChI=1S/C25H17NO7/c1-32-25(31)13-6-8-15(9-7-13)26-12-14-4-2-3-5-18(14)33-24-21(26)22(29)19-16(27)10-11-17(28)20(19)23(24)30/h2-11,29-30H,12H2,1H3 |
| InChIKey | GRZMDSKWOJBOPL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|