C20H15BN6O — CID 174061080
CID 174061080 (PubChem CID 174061080) has the molecular formula C20H15BN6O and a molecular weight of 366.19 g/mol.
| Compound Name | CID 174061080 |
|---|---|
| PubChem CID | 174061080 |
| Molecular Formula | C20H15BN6O |
| Molecular Weight | 366.19 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | — |
| SMILES | [B][C@]1(Nc2ccc3[nH]nc(-c4cnco4)c3c2)CCCc2cc(C#N)cnc21 |
| InChI | InChI=1S/C20H15BN6O/c21-20(5-1-2-13-6-12(8-22)9-24-19(13)20)25-14-3-4-16-15(7-14)18(27-26-16)17-10-23-11-28-17/h3-4,6-7,9-11,25H,1-2,5H2,(H,26,27)/t20-/m0/s1 |
| InChIKey | YWVDBYLCWHVIIA-FQEVSTJZSA-N |
| XLogP | 3.25 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.19 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|