About CID 174061588
CID 174061588 (PubChem CID 174061588) has the molecular formula C16H29B
and a molecular weight of 232.22 g/mol.
Molecular Properties
| Compound Name | CID 174061588 |
| PubChem CID | 174061588 |
| Molecular Formula | C16H29B |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.24 |
| IUPAC Name | — |
| SMILES | [B]C1(C(C)(C)C)C(CC)CC2CC(C)CC1C2 |
| InChI | InChI=1S/C16H29B/c1-6-13-9-12-7-11(2)8-14(10-12)16(13,17)15(3,4)5/h11-14H,6-10H2,1-5H3 |
| InChIKey | JJHQBRWETBRNRQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174061588 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174061588?
The IUPAC name of CID 174061588 (CID 174061588) is not available.
What is the SMILES notation for CID 174061588?
The canonical SMILES for CID 174061588 is [B]C1(C(C)(C)C)C(CC)CC2CC(C)CC1C2.
What is the InChIKey of CID 174061588?
The InChIKey is JJHQBRWETBRNRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29B/c1-6-13-9-12-7-11(2)8-14(10-12)16(13,17)15(3,4)5/h11-14H,6-10H2,1-5H3.
What are the key properties of CID 174061588?
CID 174061588 has a molecular weight of 232.22 g/mol, XLogP of 4.84, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174061588 is sourced from PubChem (CID 174061588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).