C20H28 — CID 174061787
(3Z,4S)-4-ethyl-4,7-dimethyl-3-[(2S)-2-methylcyclopentylidene]-1,2-dihydronaphthalene (PubChem CID 174061787) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is (3Z,4S)-4-ethyl-4,7-dimethyl-3-[(2S)-2-methylcyclopentylidene]-1,2-dihydronaphthalene.
| Compound Name | (3Z,4S)-4-ethyl-4,7-dimethyl-3-[(2S)-2-methylcyclopentylidene]-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 174061787 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | (3Z,4S)-4-ethyl-4,7-dimethyl-3-[(2S)-2-methylcyclopentylidene]-1,2-dihydronaphthalene |
| SMILES | CC[C@@]1(C)/C(=C2/CCC[C@@H]2C)CCc2cc(C)ccc21 |
| InChI | InChI=1S/C20H28/c1-5-20(4)18-11-9-14(2)13-16(18)10-12-19(20)17-8-6-7-15(17)3/h9,11,13,15H,5-8,10,12H2,1-4H3/b19-17-/t15-,20+/m0/s1 |
| InChIKey | BHSWRECILXGEMQ-XNUJGKRSSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|