C9H16O — CID 174061828
(2S,6R)-2,4,5,6-tetramethyl-3,6-dihydro-2H-pyran (PubChem CID 174061828) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (2S,6R)-2,4,5,6-tetramethyl-3,6-dihydro-2H-pyran.
| Compound Name | (2S,6R)-2,4,5,6-tetramethyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 174061828 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (2S,6R)-2,4,5,6-tetramethyl-3,6-dihydro-2H-pyran |
| SMILES | CC1=C(C)[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C9H16O/c1-6-5-7(2)10-9(4)8(6)3/h7,9H,5H2,1-4H3/t7-,9+/m0/s1 |
| InChIKey | WBLIVZVDENZKDC-IONNQARKSA-N |
| XLogP | 2.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|