C24H23B5F4N8O2 — CID 174062203
CID 174062203 (PubChem CID 174062203) has the molecular formula C24H23B5F4N8O2 and a molecular weight of 585.55 g/mol.
| Compound Name | CID 174062203 |
|---|---|
| PubChem CID | 174062203 |
| Molecular Formula | C24H23B5F4N8O2 |
| Molecular Weight | 585.55 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])C([B])([B])n1nccc1C(=O)NC(c1cn2ncc(CN3CC(F)(F)CNC3=O)cc2n1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C24H23B5F4N8O2/c25-23(26,27)24(28,29)41-16(3-6-35-41)19(42)38-18(14-1-4-21(30,31)5-2-14)15-10-40-17(37-15)7-13(8-36-40)9-39-12-22(32,33)11-34-20(39)43/h3,6-8,10,14,18H,1-2,4-5,9,11-12H2,(H,34,43)(H,38,42) |
| InChIKey | AAPJCAXCIHSZMG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.55 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|