C28H31FN2O — CID 174062411
14-(aminomethylidene)-18-fluoro-6,12-dimethyl-15-phenyliminopentacyclo[9.8.0.02,8.05,8.012,17]nonadeca-6,16,18-trien-10-ol (PubChem CID 174062411) has the molecular formula C28H31FN2O and a molecular weight of 430.57 g/mol. Its IUPAC name is 14-(aminomethylidene)-18-fluoro-6,12-dimethyl-15-phenyliminopentacyclo[9.8.0.02,8.05,8.012,17]nonadeca-6,16,18-trien-10-ol.
| Compound Name | 14-(aminomethylidene)-18-fluoro-6,12-dimethyl-15-phenyliminopentacyclo[9.8.0.02,8.05,8.012,17]nonadeca-6,16,18-trien-10-ol |
|---|---|
| PubChem CID | 174062411 |
| Molecular Formula | C28H31FN2O |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 14-(aminomethylidene)-18-fluoro-6,12-dimethyl-15-phenyliminopentacyclo[9.8.0.02,8.05,8.012,17]nonadeca-6,16,18-trien-10-ol |
| SMILES | CC1=CC23CC(O)C4C(C=C(F)C5=C/C(=N\c6ccccc6)C(=CN)CC54C)C2CCC13 |
| InChI | InChI=1S/C28H31FN2O/c1-16-12-28-14-25(32)26-19(21(28)9-8-20(16)28)10-23(29)22-11-24(17(15-30)13-27(22,26)2)31-18-6-4-3-5-7-18/h3-7,10-12,15,19-21,25-26,32H,8-9,13-14,30H2,1-2H3/b17-15?,31-24+ |
| InChIKey | GREJRDBSIAMKFE-CTHXROAGSA-N |
| XLogP | 5.77 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|