About 1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine
1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine (PubChem CID 174062567) has the molecular formula C14H19N5
and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine.
Molecular Properties
| Compound Name | 1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine |
| PubChem CID | 174062567 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine |
| SMILES | C/N=C/C=C(N)c1cnc2c(C(C)(C)C)nccn12 |
| InChI | InChI=1S/C14H19N5/c1-14(2,3)12-13-18-9-11(10(15)5-6-16-4)19(13)8-7-17-12/h5-9H,15H2,1-4H3/b10-5?,16-6+ |
| InChIKey | XGXJKFBLBBJGGJ-SVKOWJRDSA-N |
| XLogP | 2.03 |
| TPSA | 68.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine?
The IUPAC name of 1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine (CID 174062567) is 1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine.
What is the SMILES notation for 1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine?
The canonical SMILES for 1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine is C/N=C/C=C(N)c1cnc2c(C(C)(C)C)nccn12.
What is the InChIKey of 1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine?
The InChIKey is XGXJKFBLBBJGGJ-SVKOWJRDSA-N. The full InChI is InChI=1S/C14H19N5/c1-14(2,3)12-13-18-9-11(10(15)5-6-16-4)19(13)8-7-17-12/h5-9H,15H2,1-4H3/b10-5?,16-6+.
What are the key properties of 1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine?
1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine has a molecular weight of 257.34 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-tert-butylimidazo[1,2-a]pyrazin-3-yl)-3-methyliminoprop-1-en-1-amine is sourced from PubChem (CID 174062567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).