C16H23FOS — CID 174062837
(3S,4S,6S)-2-ethyl-6-(4-fluorophenyl)sulfanyl-3,4,5-trimethyloxane (PubChem CID 174062837) has the molecular formula C16H23FOS and a molecular weight of 282.42 g/mol. Its IUPAC name is (3S,4S,6S)-2-ethyl-6-(4-fluorophenyl)sulfanyl-3,4,5-trimethyloxane.
| Compound Name | (3S,4S,6S)-2-ethyl-6-(4-fluorophenyl)sulfanyl-3,4,5-trimethyloxane |
|---|---|
| PubChem CID | 174062837 |
| Molecular Formula | C16H23FOS |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (3S,4S,6S)-2-ethyl-6-(4-fluorophenyl)sulfanyl-3,4,5-trimethyloxane |
| SMILES | CCC1O[C@@H](Sc2ccc(F)cc2)C(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C16H23FOS/c1-5-15-11(3)10(2)12(4)16(18-15)19-14-8-6-13(17)7-9-14/h6-12,15-16H,5H2,1-4H3/t10-,11-,12?,15?,16-/m0/s1 |
| InChIKey | BZWCDQSESXGPGV-VKJWFWBLSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |