C27H48OS — CID 174062844
[(5S,7R)-7-(3-methoxybutan-2-yl)-6,7-dimethyl-5-propylundecyl]sulfanylbenzene (PubChem CID 174062844) has the molecular formula C27H48OS and a molecular weight of 420.75 g/mol. Its IUPAC name is [(5S,7R)-7-(3-methoxybutan-2-yl)-6,7-dimethyl-5-propylundecyl]sulfanylbenzene.
| Compound Name | [(5S,7R)-7-(3-methoxybutan-2-yl)-6,7-dimethyl-5-propylundecyl]sulfanylbenzene |
|---|---|
| PubChem CID | 174062844 |
| Molecular Formula | C27H48OS |
| Molecular Weight | 420.75 g/mol |
| Exact Mass | 420.34 |
| IUPAC Name | [(5S,7R)-7-(3-methoxybutan-2-yl)-6,7-dimethyl-5-propylundecyl]sulfanylbenzene |
| SMILES | CCCC[C@](C)(C(C)C(CCC)CCCCSc1ccccc1)C(C)C(C)OC |
| InChI | InChI=1S/C27H48OS/c1-8-10-20-27(6,22(3)24(5)28-7)23(4)25(16-9-2)17-14-15-21-29-26-18-12-11-13-19-26/h11-13,18-19,22-25H,8-10,14-17,20-21H2,1-7H3/t22?,23?,24?,25?,27-/m0/s1 |
| InChIKey | JQNJKEZCLQSSCR-MOOFTTKKSA-N |
| XLogP | 8.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.75 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|