About 5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine
5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine (PubChem CID 174063379) has the molecular formula C20H25B
and a molecular weight of 276.23 g/mol. Its IUPAC name is 5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine.
Molecular Properties
| Compound Name | 5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine |
| PubChem CID | 174063379 |
| Molecular Formula | C20H25B |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1ccccc1B2C(C)(C)C |
| InChI | InChI=1S/C20H25B/c1-14-11-12-18-16(13-14)20(5,6)15-9-7-8-10-17(15)21(18)19(2,3)4/h7-13H,1-6H3 |
| InChIKey | CVOBWQXIYWVCBG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine?
The IUPAC name of 5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine (CID 174063379) is 5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine.
What is the SMILES notation for 5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine?
The canonical SMILES for 5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine is Cc1ccc2c(c1)C(C)(C)c1ccccc1B2C(C)(C)C.
What is the InChIKey of 5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine?
The InChIKey is CVOBWQXIYWVCBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25B/c1-14-11-12-18-16(13-14)20(5,6)15-9-7-8-10-17(15)21(18)19(2,3)4/h7-13H,1-6H3.
What are the key properties of 5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine?
5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine has a molecular weight of 276.23 g/mol, XLogP of 4.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2,10,10-trimethylbenzo[b][1]benzoborinine is sourced from PubChem (CID 174063379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).