C60H29B7N6O — CID 174063495
CID 174063495 (PubChem CID 174063495) has the molecular formula C60H29B7N6O and a molecular weight of 925.62 g/mol.
| Compound Name | CID 174063495 |
|---|---|
| PubChem CID | 174063495 |
| Molecular Formula | C60H29B7N6O |
| Molecular Weight | 925.62 g/mol |
| Exact Mass | 926.31 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])c1c2ccccc2n2c3c4c5c(c6c7ccccc7n(-c7ccccc7)c63)Oc3c6c7c(c8c3c3ccccc3n8-c3ccccc3)n3c8ccccc8c(C([B])([B])[B])c3n7-c3cccc(c3B56)-n4c12 |
| InChI | InChI=1S/C60H29B7N6O/c61-59(62,63)44-34-22-9-13-26-38(34)70-53-49-42(32-20-7-11-24-36(32)68(49)30-16-3-1-4-17-30)55-47-51(53)72(57(44)70)40-28-15-29-41-46(40)67(47)48-52-54(71-39-27-14-10-23-35(39)45(60(64,65)66)58(71)73(41)52)50-43(56(48)74-55)33-21-8-12-25-37(33)69(50)31-18-5-2-6-19-31/h1-29H |
| InChIKey | CXVMKFSSJDTPGY-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 37.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.62 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|