C13H20O7S — CID 174063946
[(3R,4S,6R)-5-acetyloxy-6-acetylsulfanyl-3-hydroxy-4-methyloxan-2-yl]methyl acetate (PubChem CID 174063946) has the molecular formula C13H20O7S and a molecular weight of 320.36 g/mol. Its IUPAC name is [(3R,4S,6R)-5-acetyloxy-6-acetylsulfanyl-3-hydroxy-4-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6R)-5-acetyloxy-6-acetylsulfanyl-3-hydroxy-4-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 174063946 |
| Molecular Formula | C13H20O7S |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [(3R,4S,6R)-5-acetyloxy-6-acetylsulfanyl-3-hydroxy-4-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](SC(C)=O)C(OC(C)=O)[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C13H20O7S/c1-6-11(17)10(5-18-7(2)14)20-13(21-9(4)16)12(6)19-8(3)15/h6,10-13,17H,5H2,1-4H3/t6-,10?,11+,12?,13+/m0/s1 |
| InChIKey | OCKWSOKJSMOLST-HVIMGMPOSA-N |
| XLogP | 0.48 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|