C18H38O5Si2 — CID 174064375
(6aR,9R,9aS)-9-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine (PubChem CID 174064375) has the molecular formula C18H38O5Si2 and a molecular weight of 390.67 g/mol. Its IUPAC name is (6aR,9R,9aS)-9-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine.
| Compound Name | (6aR,9R,9aS)-9-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine |
|---|---|
| PubChem CID | 174064375 |
| Molecular Formula | C18H38O5Si2 |
| Molecular Weight | 390.67 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (6aR,9R,9aS)-9-methoxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine |
| SMILES | CO[C@@H]1CO[C@@H]2CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@@H]12 |
| InChI | InChI=1S/C18H38O5Si2/c1-12(2)24(13(3)4)21-11-17-18(16(19-9)10-20-17)22-25(23-24,14(5)6)15(7)8/h12-18H,10-11H2,1-9H3/t16-,17-,18+/m1/s1 |
| InChIKey | ZSFOENNUSLHIID-KURKYZTESA-N |
| XLogP | 4.36 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.67 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|