About (9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one
(9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one (PubChem CID 174064443) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is (9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one.
Molecular Properties
| Compound Name | (9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one |
| PubChem CID | 174064443 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one |
| SMILES | CCCC1=CC2=C(/C=C\C=C1)NC(=O)CC2 |
| InChI | InChI=1S/C14H17NO/c1-2-5-11-6-3-4-7-13-12(10-11)8-9-14(16)15-13/h3-4,6-7,10H,2,5,8-9H2,1H3,(H,15,16)/b4-3?,6-3?,7-4-,11-6?,11-10?,12-10?,13-7+ |
| InChIKey | CASMWZZIQDLZLW-YZHRWZJRSA-N |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one?
The IUPAC name of (9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one (CID 174064443) is (9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one.
What is the SMILES notation for (9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one?
The canonical SMILES for (9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one is CCCC1=CC2=C(/C=C\C=C1)NC(=O)CC2.
What is the InChIKey of (9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one?
The InChIKey is CASMWZZIQDLZLW-YZHRWZJRSA-N. The full InChI is InChI=1S/C14H17NO/c1-2-5-11-6-3-4-7-13-12(10-11)8-9-14(16)15-13/h3-4,6-7,10H,2,5,8-9H2,1H3,(H,15,16)/b4-3?,6-3?,7-4-,11-6?,11-10?,12-10?,13-7+.
What are the key properties of (9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one?
(9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one has a molecular weight of 215.30 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (9E)-6-propyl-3,4-dihydro-1H-cycloocta[b]pyridin-2-one is sourced from PubChem (CID 174064443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).