C53H47BFN2O2+ — CID 174064569
4-[10,12-bis(4-tert-butylphenyl)-2-fluoro-6-(4-methoxyphenyl)-8-naphthalen-1-yl-1-aza-3-azonia-2-boratricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl]benzaldehyde (PubChem CID 174064569) has the molecular formula C53H47BFN2O2+ and a molecular weight of 773.78 g/mol. Its IUPAC name is 4-[10,12-bis(4-tert-butylphenyl)-2-fluoro-6-(4-methoxyphenyl)-8-naphthalen-1-yl-1-aza-3-azonia-2-boratricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl]benzaldehyde.
| Compound Name | 4-[10,12-bis(4-tert-butylphenyl)-2-fluoro-6-(4-methoxyphenyl)-8-naphthalen-1-yl-1-aza-3-azonia-2-boratricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl]benzaldehyde |
|---|---|
| PubChem CID | 174064569 |
| Molecular Formula | C53H47BFN2O2+ |
| Molecular Weight | 773.78 g/mol |
| Exact Mass | 773.37 |
| IUPAC Name | 4-[10,12-bis(4-tert-butylphenyl)-2-fluoro-6-(4-methoxyphenyl)-8-naphthalen-1-yl-1-aza-3-azonia-2-boratricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl]benzaldehyde |
| SMILES | COc1ccc(C2=CC(c3ccc(C=O)cc3)=[N+]3B(F)n4c(-c5ccc(C(C)(C)C)cc5)cc(-c5ccc(C(C)(C)C)cc5)c4C(c4cccc5ccccc45)=C23)cc1 |
| InChI | InChI=1S/C53H47BFN2O2/c1-52(2,3)40-25-19-36(20-26-40)45-31-48(39-21-27-41(28-22-39)53(4,5)6)57-50(45)49(44-14-10-12-35-11-8-9-13-43(35)44)51-46(37-23-29-42(59-7)30-24-37)32-47(56(51)54(57)55)38-17-15-34(33-58)16-18-38/h8-33H,1-7H3/q+1 |
| InChIKey | CPSJHIMHWRIPLM-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.78 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|