About CID 174064819
CID 174064819 (PubChem CID 174064819) has the molecular formula C12H13B4NO2
and a molecular weight of 246.49 g/mol.
Molecular Properties
| Compound Name | CID 174064819 |
| PubChem CID | 174064819 |
| Molecular Formula | C12H13B4NO2 |
| Molecular Weight | 246.49 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | — |
| SMILES | [B]C1([B])Oc2ccc(C([B])([B])[C@@H](CC)NC)cc2O1 |
| InChI | InChI=1S/C12H13B4NO2/c1-3-10(17-2)11(13,14)7-4-5-8-9(6-7)19-12(15,16)18-8/h4-6,10,17H,3H2,1-2H3/t10-/m1/s1 |
| InChIKey | PRLHFCLIPAZVFI-SNVBAGLBSA-N |
| XLogP | -0.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.49 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174064819 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174064819?
The IUPAC name of CID 174064819 (CID 174064819) is not available.
What is the SMILES notation for CID 174064819?
The canonical SMILES for CID 174064819 is [B]C1([B])Oc2ccc(C([B])([B])[C@@H](CC)NC)cc2O1.
What is the InChIKey of CID 174064819?
The InChIKey is PRLHFCLIPAZVFI-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H13B4NO2/c1-3-10(17-2)11(13,14)7-4-5-8-9(6-7)19-12(15,16)18-8/h4-6,10,17H,3H2,1-2H3/t10-/m1/s1.
What are the key properties of CID 174064819?
CID 174064819 has a molecular weight of 246.49 g/mol, XLogP of -0.11, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174064819 is sourced from PubChem (CID 174064819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).