C9H11B2N3O — CID 174065059
CID 174065059 (PubChem CID 174065059) has the molecular formula C9H11B2N3O and a molecular weight of 198.83 g/mol.
| Compound Name | CID 174065059 |
|---|---|
| PubChem CID | 174065059 |
| Molecular Formula | C9H11B2N3O |
| Molecular Weight | 198.83 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCC(n2cc([B])cn2)CC1 |
| InChI | InChI=1S/C9H11B2N3O/c10-7-5-12-14(6-7)8-1-3-13(4-2-8)9(11)15/h5-6,8H,1-4H2 |
| InChIKey | NOCBDTLWAFTZOM-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.83 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|