C19H16B3F3O10S2 — CID 174065503
CID 174065503 (PubChem CID 174065503) has the molecular formula C19H16B3F3O10S2 and a molecular weight of 557.89 g/mol.
| Compound Name | CID 174065503 |
|---|---|
| PubChem CID | 174065503 |
| Molecular Formula | C19H16B3F3O10S2 |
| Molecular Weight | 557.89 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | — |
| SMILES | [B]Cc1c([B])cc([B])cc1C(=O)OC1C2CC3C1OS(=O)(=O)C3C2C(=O)OC(CS(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C19H16B3F3O10S2/c20-4-10-7(1-6(21)2-11(10)22)17(26)34-14-8-3-9-15(14)35-37(31,32)16(9)13(8)18(27)33-12(19(23,24)25)5-36(28,29)30/h1-2,8-9,12-16H,3-5H2,(H,28,29,30) |
| InChIKey | KXFDEEONCPSVTO-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.89 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|