C14H28 — CID 174065751
2,2,5,5-tetramethyl-3-methylidene-4-propan-2-ylhexane (PubChem CID 174065751) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-3-methylidene-4-propan-2-ylhexane.
| Compound Name | 2,2,5,5-tetramethyl-3-methylidene-4-propan-2-ylhexane |
|---|---|
| PubChem CID | 174065751 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 2,2,5,5-tetramethyl-3-methylidene-4-propan-2-ylhexane |
| SMILES | C=C(C(C(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H28/c1-10(2)12(14(7,8)9)11(3)13(4,5)6/h10,12H,3H2,1-2,4-9H3 |
| InChIKey | USLBEUUZCBDNDJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|