C20H31NO5Si — CID 174065801
tert-butyl 4-[4-(2-ethoxy-2-oxoethyl)phenyl]-2,2-dimethyl-4-silyl-1,3-oxazolidine-3-carboxylate (PubChem CID 174065801) has the molecular formula C20H31NO5Si and a molecular weight of 393.56 g/mol. Its IUPAC name is tert-butyl 4-[4-(2-ethoxy-2-oxoethyl)phenyl]-2,2-dimethyl-4-silyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 4-[4-(2-ethoxy-2-oxoethyl)phenyl]-2,2-dimethyl-4-silyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 174065801 |
| Molecular Formula | C20H31NO5Si |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | tert-butyl 4-[4-(2-ethoxy-2-oxoethyl)phenyl]-2,2-dimethyl-4-silyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)Cc1ccc(C2([SiH3])COC(C)(C)N2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H31NO5Si/c1-7-24-16(22)12-14-8-10-15(11-9-14)20(27)13-25-19(5,6)21(20)17(23)26-18(2,3)4/h8-11H,7,12-13H2,1-6,27H3 |
| InChIKey | NIKVZFJVVSTRMP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|