C12H21NO — CID 174066033
(1R,2E,5Z)-8-(2-methoxyethyl)-4-methylcycloocta-2,5-dien-1-amine (PubChem CID 174066033) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (1R,2E,5Z)-8-(2-methoxyethyl)-4-methylcycloocta-2,5-dien-1-amine.
| Compound Name | (1R,2E,5Z)-8-(2-methoxyethyl)-4-methylcycloocta-2,5-dien-1-amine |
|---|---|
| PubChem CID | 174066033 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (1R,2E,5Z)-8-(2-methoxyethyl)-4-methylcycloocta-2,5-dien-1-amine |
| SMILES | COCCC1C/C=C\C(C)/C=C\[C@@H]1N |
| InChI | InChI=1S/C12H21NO/c1-10-4-3-5-11(8-9-14-2)12(13)7-6-10/h3-4,6-7,10-12H,5,8-9,13H2,1-2H3/b4-3-,7-6-/t10?,11?,12-/m0/s1 |
| InChIKey | HYQXMRLDPKWBAG-NEBRUDENSA-N |
| XLogP | 2.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|