About CID 174066161
CID 174066161 (PubChem CID 174066161) has the molecular formula C78H42B10N2S2
and a molecular weight of 1179.46 g/mol.
Molecular Properties
| Compound Name | CID 174066161 |
| PubChem CID | 174066161 |
| Molecular Formula | C78H42B10N2S2 |
| Molecular Weight | 1179.46 g/mol |
| Exact Mass | 1180.37 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2cc(S(c3ccccc3)(c3ccccc3)c3ccccc3)cc(-c3c([B])c([B])c([B])c([B])c3[B])c2-n2c3ccccc3c3cc(-n4c5ccccc5c5cccc(-c6ccccc6-c6cccc7sc8ccccc8c67)c54)ccc32)c([B])c1[B] |
| InChI | InChI=1S/C78H42B10N2S2/c79-67-65(68(80)72(84)75(87)71(67)83)57-41-47(92(44-20-4-1-5-21-44,45-22-6-2-7-23-45)46-24-8-3-9-25-46)42-58(66-69(81)73(85)76(88)74(86)70(66)82)78(57)90-60-35-16-13-29-51(60)56-40-43(38-39-61(56)90)89-59-34-15-12-28-50(59)54-33-18-32-53(77(54)89)49-27-11-10-26-48(49)52-31-19-37-63-64(52)55-30-14-17-36-62(55)91-63/h1-42H |
| InChIKey | WZGAKZPILUCPDC-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 92 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1179.46 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174066161 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174066161?
The IUPAC name of CID 174066161 (CID 174066161) is not available.
What is the SMILES notation for CID 174066161?
The canonical SMILES for CID 174066161 is [B]c1c([B])c([B])c(-c2cc(S(c3ccccc3)(c3ccccc3)c3ccccc3)cc(-c3c([B])c([B])c([B])c([B])c3[B])c2-n2c3ccccc3c3cc(-n4c5ccccc5c5cccc(-c6ccccc6-c6cccc7sc8ccccc8c67)c54)ccc32)c([B])c1[B].
What is the InChIKey of CID 174066161?
The InChIKey is WZGAKZPILUCPDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C78H42B10N2S2/c79-67-65(68(80)72(84)75(87)71(67)83)57-41-47(92(44-20-4-1-5-21-44,45-22-6-2-7-23-45)46-24-8-3-9-25-46)42-58(66-69(81)73(85)76(88)74(86)70(66)82)78(57)90-60-35-16-13-29-51(60)56-40-43(38-39-61(56)90)89-59-34-15-12-28-50(59)54-33-18-32-53(77(54)89)49-27-11-10-26-48(49)52-31-19-37-63-64(52)55-30-14-17-36-62(55)91-63/h1-42H.
What are the key properties of CID 174066161?
CID 174066161 has a molecular weight of 1179.46 g/mol, XLogP of 10.20, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174066161 is sourced from PubChem (CID 174066161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).