About N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide
N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide (PubChem CID 174066194) has the molecular formula C13H13NS
and a molecular weight of 215.32 g/mol. Its IUPAC name is N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide.
Molecular Properties
| Compound Name | N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide |
| PubChem CID | 174066194 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide |
| SMILES | C=CC(=C)C=CNC(=S)c1ccccc1 |
| InChI | InChI=1S/C13H13NS/c1-3-11(2)9-10-14-13(15)12-7-5-4-6-8-12/h3-10H,1-2H2,(H,14,15) |
| InChIKey | SHXLDLOYMIPDCK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide?
The IUPAC name of N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide (CID 174066194) is N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide.
What is the SMILES notation for N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide?
The canonical SMILES for N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide is C=CC(=C)C=CNC(=S)c1ccccc1.
What is the InChIKey of N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide?
The InChIKey is SHXLDLOYMIPDCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NS/c1-3-11(2)9-10-14-13(15)12-7-5-4-6-8-12/h3-10H,1-2H2,(H,14,15).
What are the key properties of N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide?
N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide has a molecular weight of 215.32 g/mol, XLogP of 3.21, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylidenepenta-1,4-dienyl)benzenecarbothioamide is sourced from PubChem (CID 174066194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).