About 4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one
4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one (PubChem CID 174066606) has the molecular formula C7H8F2O4
and a molecular weight of 194.13 g/mol. Its IUPAC name is 4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one |
| PubChem CID | 174066606 |
| Molecular Formula | C7H8F2O4 |
| Molecular Weight | 194.13 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(OCC=CC(F)F)O1 |
| InChI | InChI=1S/C7H8F2O4/c8-5(9)2-1-3-11-6-4-12-7(10)13-6/h1-2,5-6H,3-4H2 |
| InChIKey | WMRBOHFYXSZCSJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.13 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one?
The IUPAC name of 4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one (CID 174066606) is 4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one.
What is the SMILES notation for 4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one?
The canonical SMILES for 4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one is O=C1OCC(OCC=CC(F)F)O1.
What is the InChIKey of 4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one?
The InChIKey is WMRBOHFYXSZCSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2O4/c8-5(9)2-1-3-11-6-4-12-7(10)13-6/h1-2,5-6H,3-4H2.
What are the key properties of 4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one?
4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one has a molecular weight of 194.13 g/mol, XLogP of 1.32, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-difluorobut-2-enoxy)-1,3-dioxolan-2-one is sourced from PubChem (CID 174066606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).