C28H41N3O2 — CID 174066668
N-[[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-ylidene]amino]-1-(1-adamantyl)methanamine (PubChem CID 174066668) has the molecular formula C28H41N3O2 and a molecular weight of 451.66 g/mol. Its IUPAC name is N-[[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-ylidene]amino]-1-(1-adamantyl)methanamine.
| Compound Name | N-[[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-ylidene]amino]-1-(1-adamantyl)methanamine |
|---|---|
| PubChem CID | 174066668 |
| Molecular Formula | C28H41N3O2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | N-[[(3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-methyl-2,3,4,5,7,7a-hexahydroindol-6-ylidene]amino]-1-(1-adamantyl)methanamine |
| SMILES | COc1ccc([C@@]23CCC(=NNCC45CC6CC(CC(C6)C4)C5)C[C@@H]2N(C)CC3)cc1OC |
| InChI | InChI=1S/C28H41N3O2/c1-31-9-8-28(22-4-5-24(32-2)25(13-22)33-3)7-6-23(14-26(28)31)30-29-18-27-15-19-10-20(16-27)12-21(11-19)17-27/h4-5,13,19-21,26,29H,6-12,14-18H2,1-3H3/t19?,20?,21?,26-,27?,28-/m0/s1 |
| InChIKey | YVKJAFXPFKHWMT-AJHAONLGSA-N |
| XLogP | 4.99 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|