C23H22BNO2S — CID 174066680
2-phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[g][1,3]benzothiazole (PubChem CID 174066680) has the molecular formula C23H22BNO2S and a molecular weight of 387.31 g/mol. Its IUPAC name is 2-phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[g][1,3]benzothiazole.
| Compound Name | 2-phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[g][1,3]benzothiazole |
|---|---|
| PubChem CID | 174066680 |
| Molecular Formula | C23H22BNO2S |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[g][1,3]benzothiazole |
| SMILES | CC1(C)OB(c2ccc3c(ccc4nc(-c5ccccc5)sc43)c2)OC1(C)C |
| InChI | InChI=1S/C23H22BNO2S/c1-22(2)23(3,4)27-24(26-22)17-11-12-18-16(14-17)10-13-19-20(18)28-21(25-19)15-8-6-5-7-9-15/h5-14H,1-4H3 |
| InChIKey | QSUGAIDCYADMFQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|