C21H23BF4N4O3 — CID 174067264
CID 174067264 (PubChem CID 174067264) has the molecular formula C21H23BF4N4O3 and a molecular weight of 466.24 g/mol.
| Compound Name | CID 174067264 |
|---|---|
| PubChem CID | 174067264 |
| Molecular Formula | C21H23BF4N4O3 |
| Molecular Weight | 466.24 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | — |
| SMILES | [B]C(O)(Oc1ccc(CNC(=O)N(Cc2ccc(F)cn2)C2CCNCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H23BF4N4O3/c22-20(32,21(24,25)26)33-18-5-1-14(2-6-18)11-29-19(31)30(17-7-9-27-10-8-17)13-16-4-3-15(23)12-28-16/h1-6,12,17,27,32H,7-11,13H2,(H,29,31) |
| InChIKey | UUOSBTLERDCIBD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|