C26H30N8O — CID 174067421
3-tert-butylimino-2-hydrazinylidene-N-[[2-methyl-4-[6-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyridin-4-yl]phenyl]methyl]propanamide (PubChem CID 174067421) has the molecular formula C26H30N8O and a molecular weight of 470.58 g/mol. Its IUPAC name is 3-tert-butylimino-2-hydrazinylidene-N-[[2-methyl-4-[6-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyridin-4-yl]phenyl]methyl]propanamide.
| Compound Name | 3-tert-butylimino-2-hydrazinylidene-N-[[2-methyl-4-[6-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyridin-4-yl]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 174067421 |
| Molecular Formula | C26H30N8O |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 3-tert-butylimino-2-hydrazinylidene-N-[[2-methyl-4-[6-(1-methylpyrazol-4-yl)pyrazolo[1,5-a]pyridin-4-yl]phenyl]methyl]propanamide |
| SMILES | Cc1cc(-c2cc(-c3cnn(C)c3)cn3nccc23)ccc1CNC(=O)C(/C=N/C(C)(C)C)=NN |
| InChI | InChI=1S/C26H30N8O/c1-17-10-18(6-7-19(17)12-28-25(35)23(32-27)14-29-26(2,3)4)22-11-20(21-13-31-33(5)15-21)16-34-24(22)8-9-30-34/h6-11,13-16H,12,27H2,1-5H3,(H,28,35)/b29-14+,32-23? |
| InChIKey | UQMAGFZQXIFESZ-BNVAMXOVSA-N |
| XLogP | 3.51 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|