C31H36ClN5O8S — CID 174067431
2-[[6-chloro-5-[4-[2-hydroxy-4-[[3-[[[(4S)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]methyl]phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]sulfanyl]acetic acid (PubChem CID 174067431) has the molecular formula C31H36ClN5O8S and a molecular weight of 674.18 g/mol. Its IUPAC name is 2-[[6-chloro-5-[4-[2-hydroxy-4-[[3-[[[(4S)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]methyl]phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[6-chloro-5-[4-[2-hydroxy-4-[[3-[[[(4S)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]methyl]phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 174067431 |
| Molecular Formula | C31H36ClN5O8S |
| Molecular Weight | 674.18 g/mol |
| Exact Mass | 673.20 |
| IUPAC Name | 2-[[6-chloro-5-[4-[2-hydroxy-4-[[3-[[[(4S)-2,3,4,5,6-pentahydroxyhexyl]amino]methyl]azetidin-1-yl]methyl]phenyl]phenyl]-1H-imidazo[4,5-b]pyridin-2-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nc2nc(-c3ccc(-c4ccc(CN5CC(CNCC(O)C(O)[C@@H](O)C(O)CO)C5)cc4O)cc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C31H36ClN5O8S/c32-21-8-22-30(36-31(34-22)46-15-26(42)43)35-27(21)19-4-2-18(3-5-19)20-6-1-16(7-23(20)39)11-37-12-17(13-37)9-33-10-24(40)28(44)29(45)25(41)14-38/h1-8,17,24-25,28-29,33,38-41,44-45H,9-15H2,(H,42,43)(H,34,35,36)/t24?,25?,28?,29-/m0/s1 |
| InChIKey | HZGPHNLOGQXMSQ-YQTHSLMWSA-N |
| XLogP | 1.28 |
| TPSA | 215.52 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |